| verifiedrevid | 464382415 |
|---|
| width | 250 |
|---|
| tradename | Priftin |
|---|
| medlineplus | a616011 |
|---|
| dailymedid | Rifapentine |
|---|
| routes of administration | By mouth |
|---|
| class | Macrolactam |
|---|
| atc prefix | J04 |
|---|
| atc suffix | AB05 |
|---|
| legal ca comment | Urgent Public Health Need‡R1R‡ |
|---|
| legal us | Rx-only |
|---|
| bioavailability | increases when administered with food |
|---|
| cas number | 61379-65-5 |
|---|
| pubchem | 6323497 |
|---|
| pubchem2 | 135403821 |
|---|
| drugbank | DB01201 |
|---|
| chemspiderid | 10482075 |
|---|
| unii | XJM390A33U |
|---|
| kegg | D00879 |
|---|
| kegg2 | C08059 |
|---|
| chebi | 45304 |
|---|
| chembl | 1660 |
|---|
| niaid chemdb | 007686 |
|---|
| pdb ligand | RPT |
|---|
| synonyms | 3{[(4-cyclopentyl-1-piperazinyl)imino]methyl}rifamycin |
|---|
| iupac name | (7S,9E,11S,12R,13S,14R,15R,16R,17S,18S,19E,21Z,26E)-26-{[(4-cyclopentylpiperazin-1-yl)amino]methylidene}-2,15,17,29-tetrahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-6,23,27-trioxo-8,30-dioxa-24-azatetracyclo[23.3.1.14,7.05,28]triaconta-1(28),2,4,9,19,21,25(29)-heptaen-13-yl acetate |
|---|
| c | 47 |
|---|
| h | 64 |
|---|
| n | 4 |
|---|
| o | 12 |
|---|
| smiles | CC(=O)O[C@H]3[C@H](C)[C@H](O)[C@H](C)[C@@H](O)[C@@H](C)\C=C\C=C(\C)C(=O)Nc6c(/C=N/N1CCN(CC1)C2CCCC2)c(O)c5c4C(=O)[C@@](C)(O/C=C/[C@H](OC)[C@H]3C)Oc4c(C)c(O)c5c6O |
|---|
| stdinchi | 1S/C47H64N4O12/c1-24-13-12-14-25(2)46(59)49-37-32(23-48-51-20-18-50(19-21-51)31-15-10-11-16-31)41(56)34-35(42(37)57)40(55)29(6)44-36(34)45(58)47(8,63-44)61-22-17-33(60-9)26(3)43(62-30(7)52)28(5)39(54)27(4)38(24)53/h12-14,17,22-24,26-28,31,33,38-39,43,53-57H,10-11,15-16,18-21H2,1-9H3,(H,49,59)/b13-12+,22-17+,25-14-,48-23+/t24-,26+,27+,28+,33-,38-,39+,43+,47-/m0/s1 |
|---|
| stdinchikey | WDZCUPBHRAEYDL-GZAUEHORSA-N |
|---|
| melting point | 179 |
|---|
| melting high | 180 |
|---|
